|
|
| | GARDENIN B Basic information |
| Product Name: | GARDENIN B | | Synonyms: | GARDENIN B;4',6,7,8-Tetramethoxy-5-hydroxyflavone;5-Hydroxy-4',6,7,8-tetramethoxyflavone;5-O-Desmethyltangeretin;5-DesMethyltangeretin;5-O-DeMethyltangeretin;Demethyltangeretin;Demethyltangeretin/Gardenin B | | CAS: | 2798-20-1 | | MF: | C19H18O7 | | MW: | 358.34 | | EINECS: | | | Product Categories: | Miscellaneous Natural Products | | Mol File: | 2798-20-1.mol |  |
| | GARDENIN B Chemical Properties |
| Melting point | 180-181℃ | | Boiling point | 582.0±50.0 °C(Predicted) | | density | 1.309±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | 4°C, protect from light | | solubility | Soluble in methan | | form | powder | | pka | 6.83±0.40(Predicted) | | color | Yellow | | InChI | InChI=1S/C19H18O7/c1-22-11-7-5-10(6-8-11)13-9-12(20)14-15(21)17(23-2)19(25-4)18(24-3)16(14)26-13/h5-9,21H,1-4H3 | | InChIKey | LXEVSYZNYDZSOB-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(OC)C=C2)OC2=C(OC)C(OC)=C(OC)C(O)=C2C(=O)C=1 |
| | GARDENIN B Usage And Synthesis |
| Uses | food and beverages | | Definition | ChEBI: A tetramethoxyflavone that is tangeretin in which the methoxy group at position 5 has been replaced by a hydroxy group. |
| | GARDENIN B Preparation Products And Raw materials |
| Raw materials | NSC75340-->4H-1-Benzopyran-4-one, 2-(4-hydroxyphenyl)-5,6,7,8-tetramethoxy--->Pedunculin-->(E)-1-(6-Hydroxy-2,3,4-trimethoxyphenyl)-3-(4-methoxyphenyl)-2-propen-1-one-->4-Benzyloxybenzaldehyde-->Tangeretin-->SCUTELLAREIN TETRAMETHYL ETHER-->5,4''-DIHYDROXY-6,7,8-TRIMETHOXYFLAVONE-->salvigenin-->1-(2-hydroxy-3,4,5,6-tetramethoxyphenyl)ethanone-->Dimethyl sulfate |
|