| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Products Intro: |
Product Name:4-Ethynylbenzeneboronic acid pinacol ester, 95%
CAS:1034287-04-1
Package:1g Remarks:H51745
|
| Company Name: |
Adamas Reagent, Ltd.
|
| Tel: |
400-6009262 15618770481 |
| Email: |
yhx@titansci.com |
| Products Intro: |
Product Name:2-(4-Ethynyl-Phenyl)-4,4,5,5-Tetramethyl-[1,3,2]-Dioxaborolane
CAS:1034287-04-1
Purity:97% Package:100mg;250mg;1g;5g;25g
|
|
| | 4-Ethynylbenzeneboronic acid pinacol ester, 95% Basic information |
| Product Name: | 4-Ethynylbenzeneboronic acid pinacol ester, 95% | | Synonyms: | 2-(4-Ethynyl-phenyl)-4,4,5,5-tetramethyl-[1,3,2]dioxaborolane;4-Ethynylbenzeneboronic acid pinacol ester, 95%;4-Ethynylphenylboronic acid pinacol ester;4-Ethynylbenzeneboronicacidpinacolester,95%;2-(4-Ethynyl-phenyl)-4,4,5,5-tetramethyl-[1,3,2]dioxaborolane 95+%;4-Ethynylphenylboronic acid pinacol ester 95%;4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)ethynylbenzene;1,3,2-Dioxaborolane, 2-(4-ethynylphenyl)-4,4,5,5-tetramethyl- | | CAS: | 1034287-04-1 | | MF: | C14H17BO2 | | MW: | 228.09 | | EINECS: | | | Product Categories: | | | Mol File: | 1034287-04-1.mol |  |
| | 4-Ethynylbenzeneboronic acid pinacol ester, 95% Chemical Properties |
| Melting point | 66-70°C | | Boiling point | 312.2±25.0 °C(Predicted) | | density | 1.02±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | Appearance | Off-white to light yellow Solid | | Water Solubility | Insoluble in water. | | InChI | 1S/C14H17BO2/c1-6-11-7-9-12(10-8-11)15-16-13(2,3)14(4,5)17-15/h1,7-10H,2-5H3 | | InChIKey | LOVNTFMVZVIASV-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)c2ccc(cc2)C#C |
| WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | 4-Ethynylbenzeneboronic acid pinacol ester, 95% Usage And Synthesis |
| Uses | 4-Ethynylphenylboronic acid pinacol ester can be used:
- For the functionalization of platinum nanoparticles to leverage their photoluminescence properties.
- As an intermediate in the synthesis of covalent heterodyads of chlorophyll derivatives applicable as supramolecular light-harvesting systems.
- As an intermediate in the preparation of F-18 radiolabeled galectin-3 inhibitors, which are used as surrogate positron emission tomography (PET) tracers of TD139 and GB1107.
|
| | 4-Ethynylbenzeneboronic acid pinacol ester, 95% Preparation Products And Raw materials |
|