|
|
| | tert-butyl 3-amino-1-oxa-8-azaspiro[4.5]decane-8-carboxylate Basic information |
| Product Name: | tert-butyl 3-amino-1-oxa-8-azaspiro[4.5]decane-8-carboxylate | | Synonyms: | tert-butyl 3-amino-1-oxa-8-azaspiro[4.5]decane-8-carboxylate;1-Oxa-8-azaspiro[4.5]decane-8-carboxylic acid, 3-aMino-, 1,1-diMethylethyl ester;8-Boc-3-aMino-1-oxa-8-azaspiro[4.5]decane;3-Amino-1-oxa-8-azaspiro[4.5]decane-8-carboxylic acid tert-butyl ester;tert-Butyl 3-amino-1-oxa-8-azaspiro[4.5]decane-8-carboxylate;tert-Butyl 3-amino-1-oxa-8-azaspiro[4.5]decane-8-carboxylate - [B6635];tert-Butyl 3-amino-1-oxa-8-azaspiro[4.5]decan-8-carboxylate | | CAS: | 1160246-91-2 | | MF: | C13H24N2O3 | | MW: | 256.34 | | EINECS: | | | Product Categories: | | | Mol File: | 1160246-91-2.mol | ![tert-butyl 3-amino-1-oxa-8-azaspiro[4.5]decane-8-carboxylate Structure](CAS/GIF/1160246-91-2.gif) |
| | tert-butyl 3-amino-1-oxa-8-azaspiro[4.5]decane-8-carboxylate Chemical Properties |
| Boiling point | 364.4±42.0 °C(Predicted) | | density | 1.12 | | storage temp. | 2-8°C(protect from light) | | pka | 9.77±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C13H24N2O3/c1-12(2,3)18-11(16)15-6-4-13(5-7-15)8-10(14)9-17-13/h10H,4-9,14H2,1-3H3 | | InChIKey | GBLUNQGZHFQTPW-UHFFFAOYSA-N | | SMILES | O1C2(CCN(C(OC(C)(C)C)=O)CC2)CC(N)C1 |
| WGK Germany | 3 | | HS Code | 2934999090 |
| | tert-butyl 3-amino-1-oxa-8-azaspiro[4.5]decane-8-carboxylate Usage And Synthesis |
| | tert-butyl 3-amino-1-oxa-8-azaspiro[4.5]decane-8-carboxylate Preparation Products And Raw materials |
|