|
|
| | 5-Chloro-3-(tributylstannyl)pyridine Basic information |
| Product Name: | 5-Chloro-3-(tributylstannyl)pyridine | | Synonyms: | 5-Chloro-3-(tributylstannyl)pyridine;3-(tributylstannyl)-5-chloropyridine;3-Chloro-5-(tributylstannyl)pyridine;Pyridine, 3-chloro-5-(tributylstannyl)-;SKL1085;5-Chloro-3-(tributylstannyl)pyridine - [C3119] | | CAS: | 206115-67-5 | | MF: | C17H30ClNSn | | MW: | 402.59 | | EINECS: | | | Product Categories: | Stannanes | | Mol File: | 206115-67-5.mol |  |
| | 5-Chloro-3-(tributylstannyl)pyridine Chemical Properties |
| Boiling point | 399.3±52.0 °C(Predicted) | | form | solid | | pka | 2.93±0.22(Predicted) | | InChI | 1S/C5H3ClN.3C4H9.Sn/c6-5-2-1-3-7-4-5;3*1-3-4-2;/h2-4H;3*1,3-4H2,2H3; | | InChIKey | GGSUJOOLZJBTEQ-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1cncc(Cl)c1 |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |
| | 5-Chloro-3-(tributylstannyl)pyridine Usage And Synthesis |
| | 5-Chloro-3-(tributylstannyl)pyridine Preparation Products And Raw materials |
|