|
| 1-Bromo-4-phenylnaphthalene Basic information |
Product Name: | 1-Bromo-4-phenylnaphthalene | Synonyms: | 1-Bromo-4-phenylnaphthalene;Naphthalene, 1-bromo-4-phenyl-;1KG, 5KG, 20KG, AT CUSTOMER'S REQUIREMENT;8-bromo-1-chlorodibenzo[b,d]furan;N-([1,1'-biphenyl]-4-yl)-4'-chloro-N-phenyl-[1,1'-biphenyl]-4-amine;1-Bromo-4-phenylphthalene | CAS: | 59951-65-4 | MF: | C16H11Br | MW: | 283.16 | EINECS: | | Product Categories: | OLED | Mol File: | 59951-65-4.mol |  |
| 1-Bromo-4-phenylnaphthalene Chemical Properties |
Melting point | 76-77℃ | Boiling point | 153°C/1mmHg(lit.) | density | 1.381±0.06 g/cm3 (20 ºC 760 Torr) | storage temp. | Storage temp. 2-8°C | solubility | soluble in Toluene | form | powder to crystal | color | White to Almost white | InChI | InChI=1S/C16H11Br/c17-16-11-10-13(12-6-2-1-3-7-12)14-8-4-5-9-15(14)16/h1-11H | InChIKey | ZARGVWJSXZDKRE-UHFFFAOYSA-N | SMILES | C1(Br)=C2C(C=CC=C2)=C(C2=CC=CC=C2)C=C1 |
| 1-Bromo-4-phenylnaphthalene Usage And Synthesis |
Uses |
1-Bromo-4-phenylnaphthalene is an important organic reagent that can be used as a building block for the synthesis of many organic compounds, such as 1-(4-phenylnaphthalene)-boronic acid, 4-phenylnaphthalen-1-ylboronic acid and so on.
|
| 1-Bromo-4-phenylnaphthalene Preparation Products And Raw materials |
|