| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-Bromo-4-phenylnaphthalene Basic information |
| Product Name: | 1-Bromo-4-phenylnaphthalene | | Synonyms: | 1-Bromo-4-phenylnaphthalene;Naphthalene, 1-bromo-4-phenyl-;1KG, 5KG, 20KG, AT CUSTOMER'S REQUIREMENT;N-([1,1'-biphenyl]-4-yl)-4'-chloro-N-phenyl-[1,1'-biphenyl]-4-amine;1-Bromo-4-phenylphthalene;8-bromo-1-chlorodibenzo[b,d]furan | | CAS: | 59951-65-4 | | MF: | C16H11Br | | MW: | 283.16 | | EINECS: | | | Product Categories: | OLED | | Mol File: | 59951-65-4.mol |  |
| | 1-Bromo-4-phenylnaphthalene Chemical Properties |
| Melting point | 76-77℃ | | Boiling point | 153°C/1mmHg(lit.) | | density | 1.381±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | Storage temp. 2-8°C | | solubility | soluble in Toluene | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C16H11Br/c17-16-11-10-13(12-6-2-1-3-7-12)14-8-4-5-9-15(14)16/h1-11H | | InChIKey | ZARGVWJSXZDKRE-UHFFFAOYSA-N | | SMILES | C1(Br)=C2C(C=CC=C2)=C(C2=CC=CC=C2)C=C1 |
| | 1-Bromo-4-phenylnaphthalene Usage And Synthesis |
| Uses |
1-Bromo-4-phenylnaphthalene is an important organic reagent that can be used as a building block for the synthesis of many organic compounds, such as 1-(4-phenylnaphthalene)-boronic acid, 4-phenylnaphthalen-1-ylboronic acid and so on.
|
| | 1-Bromo-4-phenylnaphthalene Preparation Products And Raw materials |
|