|
|
| | 4-CHLORO-2,5-DIFLUOROBENZOIC ACID Basic information | | Application |
| | 4-CHLORO-2,5-DIFLUOROBENZOIC ACID Chemical Properties |
| Melting point | 154-157 °C (lit.) | | Boiling point | 258°C (rough estimate) | | density | 1.4821 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline Powder | | pka | 2.70±0.10(Predicted) | | color | Off-white | | InChI | InChI=1S/C7H3ClF2O2/c8-4-2-5(9)3(7(11)12)1-6(4)10/h1-2H,(H,11,12) | | InChIKey | PEPCYJSDHYMIFN-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(F)=C(Cl)C=C1F | | CAS DataBase Reference | 132794-07-1(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-CHLORO-2,5-DIFLUOROBENZOIC ACID Usage And Synthesis |
| Application | 4-Chloro-2,5-difluorobenzoic acid is a pharmaceutical intermediate that can be used to synthesize drugs that promote insulin secretion and inhibit the increase of blood glucose concentration. It can also be used to synthesize intermediates for protein kinase inhibitors and an isothiazole derivative, which is an intermediate for an anticancer drug. | | Chemical Properties | OFF-WHITE CRYSTALLINE POWDER | | Uses | 4-Chloro-2,5-difluorobenzoic acid reacts with substituted 2-hydroxy acetophenones in the presence of POCl3 to afford 2-acetylphenyl-4-chloro-2,5-difluorobenzoate. | | General Description | 4-Chloro-2,5-difluorobenzoic acid reacts with substituted 2-hydroxy acetophenones in the presence of POCl3 to afford 2-acetylphenyl-4-chloro-2,5-difluorobenzoate. |
| | 4-CHLORO-2,5-DIFLUOROBENZOIC ACID Preparation Products And Raw materials |
|