| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Chloro[tri(p-tolyl)phosphine]gold(I),97% Basic information |
| Product Name: | Chloro[tri(p-tolyl)phosphine]gold(I),97% | | Synonyms: | chlorogold:tris(4-methylphenyl)phosphane;Chloro[tri(p-tolyl)phosphine]gold(I),97%;Chloro[tri(p-tolyl)phosphine]gold(I);Chloro(tri-4-methylphenylphosphine)gold;Chloro(tri-p-tolylphosphine)gold;Chloro(tris(p-tolyl)phosphine)gold;Chloro[tris(4-methylphenyl)phosphine]gold;oro[tri(p-toL | | CAS: | 28978-10-1 | | MF: | C21H20AuClP+ | | MW: | 535.776811 | | EINECS: | | | Product Categories: | Au | | Mol File: | 28978-10-1.mol | ![Chloro[tri(p-tolyl)phosphine]gold(I),97% Structure](CAS2/GIF/28978-10-1.gif) |
| | Chloro[tri(p-tolyl)phosphine]gold(I),97% Chemical Properties |
| Melting point | 205-210°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder | | Appearance | White to off-white Solid | | InChI | 1S/C21H21P.Au.ClH/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21;;/h4-15H,1-3H3;;1H/q;+1;/p-1 | | InChIKey | QHHGSPBDJCGVPV-UHFFFAOYSA-M | | SMILES | Cl[Au].Cc1ccc(cc1)P(c2ccc(C)cc2)c3ccc(C)cc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 1 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Chloro[tri(p-tolyl)phosphine]gold(I),97% Usage And Synthesis |
| | Chloro[tri(p-tolyl)phosphine]gold(I),97% Preparation Products And Raw materials |
|