|
|
| | Benzenemethanamine, .alpha.-methyl-4-phenoxy- Basic information |
| Product Name: | Benzenemethanamine, .alpha.-methyl-4-phenoxy- | | Synonyms: | Benzenemethanamine, .alpha.-methyl-4-phenoxy-;Benzenemethanamine, α-methyl-4-phenoxy-;1-(4-Phenoxyphenyl)ethanamine;α-Methyl-4-phenoxybenzenemethanamine;1-(4'-bromo-[1,1'-biphenyl]-4-yl)ethan-1-amine;1-(4-Phenoxyphenyl)ethan-1-amine - [P93457] | | CAS: | 102077-19-0 | | MF: | C14H15NO | | MW: | 213.27 | | EINECS: | | | Product Categories: | | | Mol File: | 102077-19-0.mol |  |
| | Benzenemethanamine, .alpha.-methyl-4-phenoxy- Chemical Properties |
| storage temp. | 2-8°C, protect from light | | form | solid | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C14H15NO/c1-11(15)12-7-9-14(10-8-12)16-13-5-3-2-4-6-13/h2-11H,15H2,1H3 | | InChIKey | WSQOGHJCBFRHSI-UHFFFAOYSA-N | | SMILES | NC(C)C(C=C1)=CC=C1OC2=CC=CC=C2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1 |
| | Benzenemethanamine, .alpha.-methyl-4-phenoxy- Usage And Synthesis |
| | Benzenemethanamine, .alpha.-methyl-4-phenoxy- Preparation Products And Raw materials |
|