N-[2-Chloro-3-formyl-4-pyridinyl]carbamic acid tert-butyl ester manufacturers
|
| | N-[2-Chloro-3-formyl-4-pyridinyl]carbamic acid tert-butyl ester Basic information |
| Product Name: | N-[2-Chloro-3-formyl-4-pyridinyl]carbamic acid tert-butyl ester | | Synonyms: | 4-(Boc-aMino)-2-chloro-3-pyridinecarbaldehyde;N-(2-chloro-3-forMyl-4-pyridinyl)carbaMic acid 1,1-diMethylethyl ester;tert-butyl N-(2-chloro-3-forMylpyridin-4-yl)carbaMate;ert-Butyl (2-chloro-3-forMylpyridin-4-yl)carbaMate;baMicacid,(2-chloro-3-forMyl-4-pyridinyl)-,1,1-;tert-Butyl N-(2-chloro-3-formyl-4-pyridyl)carbamate;tert-Butyl (2-chloro-3-formylpyridin-4-yl);N-[2-Chloro-3-formyl-4-pyridinyl]carbamic acid tert-butyl ester | | CAS: | 893423-62-6 | | MF: | C11H13ClN2O3 | | MW: | 256.69 | | EINECS: | | | Product Categories: | | | Mol File: | 893423-62-6.mol | ![N-[2-Chloro-3-formyl-4-pyridinyl]carbamic acid tert-butyl ester Structure](CAS/GIF/893423-62-6.gif) |
| | N-[2-Chloro-3-formyl-4-pyridinyl]carbamic acid tert-butyl ester Chemical Properties |
| Boiling point | 332℃ | | density | 1.314 | | Fp | 155℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 11.46±0.70(Predicted) | | form | crystalline powder | | color | White | | InChI | 1S/C11H13ClN2O3/c1-11(2,3)17-10(16)14-8-4-5-13-9(12)7(8)6-15/h4-6H,1-3H3,(H,13,14,16) | | InChIKey | YNHFPXDHWTUUCL-UHFFFAOYSA-N | | SMILES | O=C(OC(C)(C)C)NC1=C(C=O)C(Cl)=NC=C1 |
| HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | N-[2-Chloro-3-formyl-4-pyridinyl]carbamic acid tert-butyl ester Usage And Synthesis |
| Uses | 4-(Boc-amino)-2-chloro-3-pyridinecarbaldehyde is used as a reagent in the synthesis of naphthyridinones as allosteric dual Akt1 and Akt2 inhibitors. |
| | N-[2-Chloro-3-formyl-4-pyridinyl]carbamic acid tert-butyl ester Preparation Products And Raw materials |
|