| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Dichloro[1,3-Bis(2-methylphenyl)-2-imidazolidinylidene](benzylidene)(tricyclohexylphosphine)ruthenium(II) Basic information |
| | Dichloro[1,3-Bis(2-methylphenyl)-2-imidazolidinylidene](benzylidene)(tricyclohexylphosphine)ruthenium(II) Chemical Properties |
| Melting point | 160.5-161.0°C | | storage temp. | 2-8°C | | form | solid | | InChIKey | MYBIVOYIHBQJIU-UHFFFAOYSA-L | | SMILES | C1CCC(CC1)P(C2CCCCC2)C3CCCCC3.Cc4ccccc4N5CCN(C5[Ru](Cl)(Cl)=Cc6ccccc6)c7ccccc7C |
| Hazard Codes | F | | Risk Statements | 11 | | RIDADR | UN1325 - class 4.1 - PG 2 - Flammable solids, organic, n.o.s., HI: all | | WGK Germany | 3 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Flam. Sol. 2 |
| | Dichloro[1,3-Bis(2-methylphenyl)-2-imidazolidinylidene](benzylidene)(tricyclohexylphosphine)ruthenium(II) Usage And Synthesis |
| Uses | - Highly reactive in metathesis of sterically hindered olefins, particularly in Ring-Closing Metathesis (RCM).
- Useful for the preparation of tetrasubstituted olefins via RCM.
- Enabling metathesis catalyst.
|
| | Dichloro[1,3-Bis(2-methylphenyl)-2-imidazolidinylidene](benzylidene)(tricyclohexylphosphine)ruthenium(II) Preparation Products And Raw materials |
|