| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Dichloro[2-(4,5-dihydro-2-oxazolyl)quinoline]palladium(II) Basic information |
| | Dichloro[2-(4,5-dihydro-2-oxazolyl)quinoline]palladium(II) Chemical Properties |
| Melting point | 285 °C (decomp) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder | | InChI | 1S/C12H10N2O.2ClH.Pd/c1-2-4-10-9(3-1)5-6-11(14-10)12-13-7-8-15-12;;;/h1-6H,7-8H2;2*1H;/q;;;+2/p-2 | | InChIKey | DQWIOWASGZSKNG-UHFFFAOYSA-L | | SMILES | Cl[Pd]Cl.C1CN=C(O1)c2ccc3ccccc3n2 |
| Hazard Codes | Xn | | Risk Statements | 22-36-38-43 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 |
| | Dichloro[2-(4,5-dihydro-2-oxazolyl)quinoline]palladium(II) Usage And Synthesis |
| reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Cross Couplings reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst core: palladium reagent type: ligand |
| | Dichloro[2-(4,5-dihydro-2-oxazolyl)quinoline]palladium(II) Preparation Products And Raw materials |
|