| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | tert-butyl (2-chloropyridin-3-yl)carbamate Basic information |
| Product Name: | tert-butyl (2-chloropyridin-3-yl)carbamate | | Synonyms: | tert-butyl (2-chloropyridin-3-yl)carbamate;(2-Chloro-pyridin-3-yl)-carbaMic acid tert-butyl ester;tert-butyl N-(2-chloropyridin-3-yl)carbamate;Carbamic acid, N-(2-chloro-3-pyridinyl)-, 1,1-dimethylethyl ester;3-(Boc-amino)-2-chloropyridine | | CAS: | 209798-48-1 | | MF: | C10H13ClN2O2 | | MW: | 228.68 | | EINECS: | | | Product Categories: | | | Mol File: | 209798-48-1.mol |  |
| | tert-butyl (2-chloropyridin-3-yl)carbamate Chemical Properties |
| Melting point | 84-85 °C(Solv: isopropanol (67-63-0)) | | Boiling point | 279.6±25.0 °C(Predicted) | | density | 1.245±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 12.00±0.70(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C10H13ClN2O2/c1-10(2,3)15-9(14)13-7-5-4-6-12-8(7)11/h4-6H,1-3H3,(H,13,14) | | InChIKey | VUHVCMJKJLGRJX-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NC1=CC=CN=C1Cl |
| | tert-butyl (2-chloropyridin-3-yl)carbamate Usage And Synthesis |
| | tert-butyl (2-chloropyridin-3-yl)carbamate Preparation Products And Raw materials |
|