| Company Name: |
Mainchem Co., Ltd.
|
| Tel: |
+86-0592-6210733 |
| Email: |
sale@mainchem.com |
| Products Intro: |
Product Name:2,6-DIAMINOPIMELIC ACID
CAS:2577-62-0
|
|
| | 2,6-DIAMINOPIMELIC ACID Basic information |
| Product Name: | 2,6-DIAMINOPIMELIC ACID | | Synonyms: | DIAMINOPIMELIC ACID, 2,6-;DL-2,6-DIAMINOPIMELIC ACID;DL-2,6-DIAMINOHEPTANEDIOIC ACID;DL-ALPHA,EPSILON-DIAMINOPIMELIC ACID;H-(LL,DL,MESO)DAPIM-OH;H-DL-DAPM-OH;2,6-DIAMINOHEPTANEDIOIC ACID;2,6-DIAMINOPIMELIC ACID | | CAS: | 2577-62-0 | | MF: | C7H14N2O4 | | MW: | 190.2 | | EINECS: | 629-070-6 | | Product Categories: | Amino Acids | | Mol File: | 2577-62-0.mol |  |
| | 2,6-DIAMINOPIMELIC ACID Chemical Properties |
| Melting point | ~295 °C (dec.)(lit.) | | Boiling point | 426.7±45.0 °C(Predicted) | | density | 1.344±0.06 g/cm3(Predicted) | | form | powder | | pka | 2.20±0.24(Predicted) | | InChI | 1S/C7H14N2O4/c8-4(6(10)11)2-1-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5-/m0/s1 | | InChIKey | GMKMEZVLHJARHF-WHFBIAKZSA-N | | SMILES | OC([C@@H](N)CCC[C@H](N)C(O)=O)=O | | CAS DataBase Reference | 2577-62-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,6-DIAMINOPIMELIC ACID Usage And Synthesis |
| Uses | DL-2,6-Diaminopimelic acid, a stereoisomer of meso-DAP, may be used as a reference material in assays used to identify markers of bacteria and fungi in the rumen of ruminants. | | Biochem/physiol Actions | Stereoisomer of meso-DAP. meso-DAP is a biosynthetic precursor of the essential amino acid L-lysine and component of peptidoglycan in the cell wall of many bacteria. As these functions are not observed in mammalian biochemistry, alpha,alpha′-diamino diacids (DADs) are of interest as potential antibiotics with low mammalian toxicity. |
| | 2,6-DIAMINOPIMELIC ACID Preparation Products And Raw materials |
|