| Company Name: |
Hubei Rhema Reference Materials Technology Co., Ltd. Gold
|
| Tel: |
15787879035 15787875101 |
| Email: |
ydw9035@rmastandards.com |
| Products Intro: |
Product Name:2,4-Dichloro-5-trichloromethylpyrimidine
CAS:153600-16-9
Purity:96% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:2,4-Dichloro-5-trichloromethylpyrimidine
CAS:153600-16-9
Purity:98% Remarks:B62297
|
|
| | 2,4-Dichloro-5-trichloromethylpyrimidine Basic information |
| | 2,4-Dichloro-5-trichloromethylpyrimidine Chemical Properties |
| Boiling point | 334.8±37.0 °C(Predicted) | | density | 1.762±0.06 g/cm3(Predicted) | | pka | -4.65±0.29(Predicted) | | InChI | InChI=1S/C5HCl5N2/c6-3-2(5(8,9)10)1-11-4(7)12-3/h1H | | InChIKey | ATGNCJJTENOVMC-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C(C(Cl)(Cl)Cl)C(Cl)=N1 |
| | 2,4-Dichloro-5-trichloromethylpyrimidine Usage And Synthesis |
| | 2,4-Dichloro-5-trichloromethylpyrimidine Preparation Products And Raw materials |
|