3-Pyridinecarboxylic acid, 6-chloro-4-methoxy-, methyl ester manufacturers
|
| | 3-Pyridinecarboxylic acid, 6-chloro-4-methoxy-, methyl ester Basic information |
| | 3-Pyridinecarboxylic acid, 6-chloro-4-methoxy-, methyl ester Chemical Properties |
| Boiling point | 283.6±35.0℃ (760 Torr) | | density | 1.288±0.06 g/cm3 (20 ºC 760 Torr) | | Fp | 125.3±25.9℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 0.04±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H8ClNO3/c1-12-6-3-7(9)10-4-5(6)8(11)13-2/h3-4H,1-2H3 | | InChIKey | CRTSQMSTPZTUDW-UHFFFAOYSA-N | | SMILES | C1=NC(Cl)=CC(OC)=C1C(OC)=O |
| HazardClass | IRRITANT | | HS Code | 2933399990 |
| | 3-Pyridinecarboxylic acid, 6-chloro-4-methoxy-, methyl ester Usage And Synthesis |
| | 3-Pyridinecarboxylic acid, 6-chloro-4-methoxy-, methyl ester Preparation Products And Raw materials |
|