Methyl 5-hydroxy-4-methoxy-2-nitrobenzoate manufacturers
|
| | Methyl 5-hydroxy-4-methoxy-2-nitrobenzoate Basic information |
| Product Name: | Methyl 5-hydroxy-4-methoxy-2-nitrobenzoate | | Synonyms: | Methyl 5-hydroxy-4-Methoxy-3-nitrobenzoate;5-Hydroxy-4-methoxy-2-nitro-benzoic acid methyl ester;Benzoic acid, 5-hydroxy-4-methoxy-2-nitro-, methyl ester;GEFITINIB - METHYL 5-HYDROXY - 4-METHOXY-2- NITROBENZOATE;2-NITRO-4-METHOXY-5-HYDROXY METHYLBENZOATE;Methyl 5-hydroxy-4-methoxy-2-nitrobenzoate | | CAS: | 215659-03-3 | | MF: | C9H9NO6 | | MW: | 227.17 | | EINECS: | | | Product Categories: | | | Mol File: | 215659-03-3.mol |  |
| | Methyl 5-hydroxy-4-methoxy-2-nitrobenzoate Chemical Properties |
| Boiling point | 419.5±45.0 °C(Predicted) | | density | 1.405±0.06 g/cm3(Predicted) | | Fp | 146 °C | | storage temp. | Sealed in dry,Room Temperature | | pka | 6.20±0.24(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H9NO6/c1-15-8-4-6(10(13)14)5(3-7(8)11)9(12)16-2/h3-4,11H,1-2H3 | | InChIKey | ZKUUVVYMPUDTGJ-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(O)=C(OC)C=C1[N+]([O-])=O |
| | Methyl 5-hydroxy-4-methoxy-2-nitrobenzoate Usage And Synthesis |
| Description | Methyl 5-hydroxy-4-methoxy-2-nitrobenzoate is an organic compound with the ability to induce apoptosis in cancer cells. |
| | Methyl 5-hydroxy-4-methoxy-2-nitrobenzoate Preparation Products And Raw materials |
|