|
|
| | 3-(Methylsulphonyl)benzyl bromide 97% Basic information |
| Product Name: | 3-(Methylsulphonyl)benzyl bromide 97% | | Synonyms: | 3-(Methylsulphonyl)benzyl bromide 97%;1-(BroMoMethyl)-3-(Methylsulfonyl)benzene;1-(Bromomethyl)-3-(methylsulphonyl)benzene, 3-(Bromomethyl)phenyl methyl sulphone;Benzene, 1-(broMoMethyl)-3-(Methylsulfonyl)-;1-(Bromomethyl)-3-(methylsulphonyl)benzene;3-(Methyl sulphonyl) benzyl broMide;3-(Methylsulphonyl)benzylbromide97%;3-Methylsulfonylbenzyl bromide | | CAS: | 82657-76-9 | | MF: | C8H9BrO2S | | MW: | 249.12 | | EINECS: | | | Product Categories: | | | Mol File: | 82657-76-9.mol |  |
| | 3-(Methylsulphonyl)benzyl bromide 97% Chemical Properties |
| Boiling point | 390.0±34.0 °C(Predicted) | | density | 1.550±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder | | color | Beige to faint lemon | | InChI | 1S/C8H9BrO2S/c1-12(10,11)8-4-2-3-7(5-8)6-9/h2-5H,6H2,1H3 | | InChIKey | JRXBZWXKAYJVRI-UHFFFAOYSA-N | | SMILES | CS(=O)(C1=CC=CC(CBr)=C1)=O |
| RIDADR | 3261 | | HazardClass | 8 | | PackingGroup | Ⅲ | | HS Code | 2930909899 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-(Methylsulphonyl)benzyl bromide 97% Usage And Synthesis |
| | 3-(Methylsulphonyl)benzyl bromide 97% Preparation Products And Raw materials |
|