|
|
| | 1-amino-3-(1-piperidinyl)-2-propanol Basic information |
| Product Name: | 1-amino-3-(1-piperidinyl)-2-propanol | | Synonyms: | 1-amino-3-piperidino-propan-2-ol;1-amino-3-(1-piperidinyl)-2-propanol(SALTDATA: FREE);1-amino-3-(1-piperidinyl)-2-propanol;1-Piperidineethanol, α-(aminomethyl)- | | CAS: | 39849-46-2 | | MF: | C8H18N2O | | MW: | 158.24 | | EINECS: | | | Product Categories: | | | Mol File: | 39849-46-2.mol |  |
| | 1-amino-3-(1-piperidinyl)-2-propanol Chemical Properties |
| Boiling point | 128-133 °C(Press: 15 Torr) | | density | 1.033±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 12.68±0.35(Predicted) | | InChI | InChI=1S/C8H18N2O/c9-6-8(11)7-10-4-2-1-3-5-10/h8,11H,1-7,9H2 | | InChIKey | VOQTZJYNVJFIJW-UHFFFAOYSA-N | | SMILES | N1(CCCCC1)CC(CN)O |
| | 1-amino-3-(1-piperidinyl)-2-propanol Usage And Synthesis |
| | 1-amino-3-(1-piperidinyl)-2-propanol Preparation Products And Raw materials |
|