| Company Name: |
Accela ChemBio Inc. |
| Tel: |
+1-858-6993322 +86-18019713315 |
| Email: |
info@accelachem.com |
|
| | 4-chloro-7-methoxyquinolin-6-ol Basic information |
| | 4-chloro-7-methoxyquinolin-6-ol Chemical Properties |
| Boiling point | 331.6±37.0 °C(Predicted) | | density | 1.386±0.06 g/cm3(Predicted) | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 8.49±0.40(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C10H8ClNO2/c1-14-10-5-8-6(4-9(10)13)7(11)2-3-12-8/h2-5,13H,1H3 | | InChIKey | GXGHEFVSWVGPAO-UHFFFAOYSA-N | | SMILES | N1C2C(=CC(O)=C(OC)C=2)C(Cl)=CC=1 |
| | 4-chloro-7-methoxyquinolin-6-ol Usage And Synthesis |
| Uses | 4-Chloro-7-methoxyquinolin-6-ol is an intermediate used in the synthesis of quinoline derivatives with antineoplastic and antibacterial properties. |
| | 4-chloro-7-methoxyquinolin-6-ol Preparation Products And Raw materials |
|