|
|
| Product Name: | 1,3-Dibromo-5-octyl-4H-thieno[3,4-c]pyrrole-4,6(5H)-dione | | Synonyms: | 1,3-Dibromo-5-octyl-4H-thieno[3,4-c]pyrrole-4,6(5H)-dione;4H-Thieno[3,4-c]pyrrole-4,6(5H)-dione, 1,3-dibroMo-5-octyl-;2,5-DibroMo-N-n-octyl-3,4-thiophenedicarboxiMide;1,3-dibromo-5-octylthieno[3,4-cpyrrole-4,6-dione;1,3-dibromo-5-(n-octyl)-4H-thieno[3,4-c]pyrrole-4,6(5H)-dione;2,5-Dibromo-N-n-octyl-3,4-thiophenedicarboximide;1,3-dibromo-5-octylthieno[3,4-cpy;TPD8-2Br | | CAS: | 566939-58-0 | | MF: | C14H17Br2NO2S | | MW: | 423.16 | | EINECS: | | | Product Categories: | | | Mol File: | 566939-58-0.mol | ![1,3-Dibromo-5-octyl-4H-thieno[3,4-c]pyrrole-4,6(5H)-dione Structure](CAS/GIF/566939-58-0.gif) |
| | 1,3-Dibromo-5-octyl-4H-thieno[3,4-c]pyrrole-4,6(5H)-dione Chemical Properties |
| Melting point | 105.0 to 109.0 °C | | Boiling point | 457.8±45.0 °C(Predicted) | | density | 1.621 | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | -3.32±0.20(Predicted) | | form | powder to crystal | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C14H17Br2NO2S/c1-2-3-4-5-6-7-8-17-13(18)9-10(14(17)19)12(16)20-11(9)15/h2-8H2,1H3 | | InChIKey | GSGMEQUXTCYOAU-UHFFFAOYSA-N | | SMILES | N1(CCCCCCCC)C(=O)C2=C(Br)SC(Br)=C2C1=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2934.99.9001 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1,3-Dibromo-5-octyl-4H-thieno[3,4-c]pyrrole-4,6(5H)-dione Usage And Synthesis |
| Classification | Thiophene, Heterocyclic five-membered ring, Organic semiconducting materials, Semiconductor Synthesis, Low band gap polymers, OFETs, OLED, Organic Photovoltaics, Polymer Solar Cells.
| | Applications | 1,3-Dibromo-5-octyl-4H-thieno[3,4-c]pyrrole-4,6(5H)-dione, also referred to as TPD-C8, is electron-deficient and used as a monomer for the synthesis of low band-gap polymer semiconductors in OPV and OFET applications.
| | Description | 1,3-Dibromo-5-octyl-4H-thieno[3,4-c]pyrrole-4,6(5H)-dione, also referred to as TPD-C8, is electron-deficient and used as a monomer for the synthesis of low band-gap polymer semiconductors in OPV and OFET applications. | | Uses | Used as an electron acceptor material (n-type semiconductor) in Polymer Solar Cells. | | Uses | suzuki reaction | | General Description | 1,3-Dibromo-5-octyl-4H-thieno[3,4-c]pyrrole-4,6(5H)-dione is a thienopyrrolodione (TPD) based electron acceptor material (n-type semiconductor) which is used widely for organic photovoltaic (OPV) applications. They have very powerful electron withdrawing capability. TPD based conjugated polymers have exhibited a Power Conversion Efficiency (PCE) of as high as 7.3% in bulk heterojunction polymer solar cells. |
| | 1,3-Dibromo-5-octyl-4H-thieno[3,4-c]pyrrole-4,6(5H)-dione Preparation Products And Raw materials |
| Raw materials | 3,4-Thiophenedicarbonyl dichloride, 2,5-dibromo--->thieno[3,4-c]pyrrole-4,6-dione-->Thiophene-3,4-dicarboxylic acid-->4H-Thieno[3,4-c]pyrrole-4,6(5H)-dione, 1,3-dibromo--->5-octyl-5H-thieno[3,4-c]pyrrole-4,6-dione-->3,4-Thiophenedicarboxylic Anhydride-->4,6-DibroMothieno[3,4-c]furan-1,3-dione-->2,5-DibroMothiophene-3,4-dicarboxylic acid-->3,4-DICYANOTHIOPHENE,-->1-Bromooctane-->Octylamine |
|