|
|
| | (1H-imidazol-4-yl)methanone Basic information |
| Product Name: | (1H-imidazol-4-yl)methanone | | Synonyms: | Methanone, (2,3-dimethylphenyl)-1H-imidazol-4-yl- chemistry;Methanone, (2,3-dimethylphenyl)-1H-imidazol-4-yl-;Dexmedetomidine Hydrochloride Impurity D;Dexmedetomidine-023;Medetomidine Ketone Impurity;Medetomidine RC8;Methanone, (2,3-dimethylphenyl)-1H-imidazol-5-yl-;(1H-imidazol-4-yl)methanone | | CAS: | 91874-85-0 | | MF: | C12H12N2O | | MW: | 200.24 | | EINECS: | | | Product Categories: | | | Mol File: | 91874-85-0.mol |  |
| | (1H-imidazol-4-yl)methanone Chemical Properties |
| Boiling point | 412.7±33.0 °C(Predicted) | | density | 1.166±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 10.30±0.10(Predicted) | | form | Solid | | color | White to Pale Brown | | Major Application | pharmaceutical | | InChI | InChI=1S/C12H12N2O/c1-8-4-3-5-10(9(8)2)12(15)11-6-13-7-14-11/h3-7H,1-2H3,(H,13,14) | | InChIKey | RXMJMOMMINVJMY-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC(C)=C1C)(C1NC=NC=1)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 2 |
| | (1H-imidazol-4-yl)methanone Usage And Synthesis |
| Uses | (2,3-Dimethylphenyl)-1H-imidazol-5-ylmethanone was used for tandem addition reduction to synthesize 4(5)-[1-(2,3-dimethylphenyl)-1H-imidazole, the α2-adrenergic agonist medetomidine. |
| | (1H-imidazol-4-yl)methanone Preparation Products And Raw materials |
|