|
|
| | 3-FluorocyclobutanaMine Hydrochloride Basic information |
| | 3-FluorocyclobutanaMine Hydrochloride Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C4H8FN.ClH/c5-3-1-4(6)2-3;/h3-4H,1-2,6H2;1H | | InChIKey | WEBFDQGKSKHFDN-UHFFFAOYSA-N | | SMILES | FC1CC(N)C1.Cl |
| | 3-FluorocyclobutanaMine Hydrochloride Usage And Synthesis |
| Uses | 3-Fluorocyclobutanamine hydrochloride is a 3-halo substituted cyclobutanamine used in the preparation of piperazinyl antiviral agents. |
| | 3-FluorocyclobutanaMine Hydrochloride Preparation Products And Raw materials |
|