- Famotidine Compound D
-
- $0.00 / 10mg
-
2025-12-19
- CAS:76824-16-3
- Min. Order: 10mg
- Purity: 90%+
- Supply Ability: 10g
|
| | FaMotidine AMide IMpurity Basic information |
| Product Name: | FaMotidine AMide IMpurity | | Synonyms: | Famotidine Related Compound D (25 mg) (3-[[2-(diaminomethyleneamino)thiazol-4-yl]methylthio]propanamide);FaMotidine EP IMpurity D;FaMotidine AMide IMpurity;3-[[[2-[(AMinoiMinoMethyl)aMino]-4-thiazolyl]Methyl]thio]propanaMide;FaMotidine Related CoMpound D;Famotidine EP Impurity D (USP RC D);Famotidine Impurity Ⅱ:3-[[[2-[(Aminoiminomethyl)amino]-4-thiazolyl]methyl]thio]propanamide;3-[({2-[(Diaminomethylene)amino]-1,3-thiazol-4-yl}methyl)sulfanyl ]propanamide | | CAS: | 76824-16-3 | | MF: | C8H13N5OS2 | | MW: | 259.35 | | EINECS: | | | Product Categories: | Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals | | Mol File: | 76824-16-3.mol |  |
| | FaMotidine AMide IMpurity Chemical Properties |
| Melting point | >140°C (dec.) | | Boiling point | 530.5±60.0 °C(Predicted) | | density | 1.63±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Ethanol (Slightly, Sonicated), Methanol (Slightly, Heated, Sonicated） | | pka | 16.19±0.40(Predicted) | | form | powder | | color | White to Pale Yellow | | biological source | synthetic | | Stability: | Hygroscopic | | InChI | InChI=1S/C8H13N5OS2/c9-6(14)1-2-15-3-5-4-16-8(12-5)13-7(10)11/h4H,1-3H2,(H2,9,14)(H4,10,11,12,13) | | InChIKey | BLXXXPVCYVHTQA-UHFFFAOYSA-N | | SMILES | C(N)(=O)CCSCC1=CSC(NC(N)=N)=N1 |
| | FaMotidine AMide IMpurity Usage And Synthesis |
| | FaMotidine AMide IMpurity Preparation Products And Raw materials |
|