| | Tapentadol O-Sulfate Basic information |
| | Tapentadol O-Sulfate Chemical Properties |
| density | 1.178±0.06 g/cm3(Predicted) | | Fp | 9℃ | | storage temp. | -20°C | | pka | -3.95±0.18(Predicted) | | form | liquid | | Major Application | forensics and toxicology | | InChI | 1S/C14H23NO4S/c1-5-14(11(2)10-15(3)4)12-7-6-8-13(9-12)19-20(16,17)18/h6-9,11,14H,5,10H2,1-4H3,(H,16,17,18)/t11-,14+/m0/s1 | | InChIKey | HPEFZESOUVTBSA-SMDDNHRTSA-N | | SMILES | CC[C@H]([C@@H](C)CN(C)C)c1cccc(OS(O)(=O)=O)c1 |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | Tapentadol O-Sulfate Usage And Synthesis |
| Uses | A metabolite of Tapentadol (T007200). |
| | Tapentadol O-Sulfate Preparation Products And Raw materials |
|