|
|
| | 4-CHLORO-7-METHOXY-6-NITROQUINAZOLINE Basic information |
| Product Name: | 4-CHLORO-7-METHOXY-6-NITROQUINAZOLINE | | Synonyms: | 4-CHLORO-7-METHOXY-6-NITROQUINAZOLINE;New 4-CHLORO-7-METHOXY-6-NITROQUINAZOLINE;Quinazoline, 4-chloro-7-methoxy-6-nitro-;4-chloro-6-nitro-7-methoxyquinazoline;7-methoxy-6-nitro-4-chloroquinazoline | | CAS: | 55496-69-0 | | MF: | C9H6ClN3O3 | | MW: | 239.62 | | EINECS: | 000-000-0 | | Product Categories: | | | Mol File: | 55496-69-0.mol |  |
| | 4-CHLORO-7-METHOXY-6-NITROQUINAZOLINE Chemical Properties |
| Boiling point | 424.6±40.0 °C(Predicted) | | density | 1.518±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 0.53±0.70(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C9H6ClN3O3/c1-16-8-3-6-5(2-7(8)13(14)15)9(10)12-4-11-6/h2-4H,1H3 | | InChIKey | MJFJWOAETHEGGW-UHFFFAOYSA-N | | SMILES | N1=C2C(C=C([N+]([O-])=O)C(OC)=C2)=C(Cl)N=C1 |
| | 4-CHLORO-7-METHOXY-6-NITROQUINAZOLINE Usage And Synthesis |
| Synthesis | Step 22d. Synthesis of 4-chloro-7-methoxy-6-nitroquinazoline (Compound 0305): 7-methoxy-6-nitroquinazolin-4(3H)-one (Compound 0304, 3.8 g, 17.2 mmol) was suspended in phosphorus oxychloride (POCl3, 75 mL), and the reaction mixture was heated to reflux and maintained for 4 hours. Upon completion of the reaction, excess POCl3 was removed by distillation under reduced pressure. the residue was dissolved in a mixture of dichloromethane (50 mL) and aqueous sodium bicarbonate (NaHCO3) (50 mL), and the organic layer was separated and dried over anhydrous sodium sulfate. The solvent was removed by concentration under reduced pressure to afford the target product 4-chloro-7-methoxy-6-nitroquinazoline (compound 0305, 3.4 g, 83% yield). The product was characterized by 1H NMR (DMSO-d6): δ 4.05 (s, 3H), 7.44 (s, 1H), 8.27 (s, 1H), 8.53 (s, 1H). | | References | [1] Journal of Medicinal Chemistry, 1996, vol. 39, # 1, p. 267 - 276
[2] Patent: WO2008/33747, 2008, A2. Location in patent: Page/Page column 130
[3] Patent: US2009/76022, 2009, A1. Location in patent: Page/Page column 74-75
[4] Journal of Medicinal Chemistry, 2010, vol. 53, # 5, p. 2000 - 2009
[5] Patent: US2009/111772, 2009, A1. Location in patent: Page/Page column 73 |
| | 4-CHLORO-7-METHOXY-6-NITROQUINAZOLINE Preparation Products And Raw materials |
|