| Company Name: |
GLP Pharma Standards
|
| Tel: |
+91 9866074638 |
| Email: |
info@glppharmastandards.com |
| Products Intro: |
Product Name:Glipizide EP Impurity F/Glipizide BP Impurity F CAS:192118-08-4 Purity:NLT 95% Package:25 MG 50 MG 100 MG 250 MG EXTRA
|
| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:[2-[4-(AMinosulfonyl)phenyl]ethyl]carbaMic Acid Ethyl Ester CAS:192118-08-4 Package:100Mg,1g
|
| Company Name: |
Chemsky (shanghai) International Co.,Ltd
|
| Tel: |
021-50135380 |
| Email: |
shchemsky@sina.com |
| Products Intro: |
Product Name:[2-[4-(AMinosulfonyl)phenyl]ethyl]carbaMic Acid Ethyl Ester CAS:192118-08-4 Purity:98+% Package:1Mg;5Mg;10Mg;50Mg;100Mg;500Mg
|
|
| | [2-[4-(AMinosulfonyl)phenyl]ethyl]carbaMic Acid Ethyl Ester Basic information |
| | [2-[4-(AMinosulfonyl)phenyl]ethyl]carbaMic Acid Ethyl Ester Chemical Properties |
| Melting point | 165-166°C | | storage temp. | Refrigerator, under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White | | InChI | InChI=1S/C11H16N2O4S/c1-2-17-11(14)13-8-7-9-3-5-10(6-4-9)18(12,15)16/h3-6H,2,7-8H2,1H3,(H,13,14)(H2,12,15,16) | | InChIKey | ZOZIYFMAJSPBLQ-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)NCCC1=CC=C(S(N)(=O)=O)C=C1 |
| | [2-[4-(AMinosulfonyl)phenyl]ethyl]carbaMic Acid Ethyl Ester Usage And Synthesis |
| Uses | Glipizide (G410225) impurity. |
| | [2-[4-(AMinosulfonyl)phenyl]ethyl]carbaMic Acid Ethyl Ester Preparation Products And Raw materials |
|