| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | Terbinafine DiMer IMpurity Basic information |
| Product Name: | Terbinafine DiMer IMpurity | | Synonyms: | Terbinafine DiMer IMpurity;Terbinafine Impurity E;Terbinafine EP Impurity E;(2E,4E)-4-(4,4-DiMethyl-2-pentyn-1-ylidene)-N1,N5-diMethyl-N1,N5-bis(1-naphthalenylMethyl)-2-pentene-1,5-diaMine;Terbinafine DiMer IMpurity Dihydrochloride Salt;(2E,4E)-4-(4,4-Dimethyl-2-pentyn-1-ylidene)-N1,N5-dimethyl-N1,N5-bis(1-naphthalenylmethyl)-2-pentene-1,5-diamine, dichloride;(2E,4E)-4-(4,4-dimethylpent-2-yn-1-ylidene)-N1,N5-dimethyl-N1,N5-bis(naphthalen-1-ylmethyl)pent-2-ene-1,5-diamine dihydrochloride;Terbinafine Dimer | | CAS: | 934365-23-8 | | MF: | C36H40N2 | | MW: | 500.72 | | EINECS: | | | Product Categories: | Amines;Aromatics;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 934365-23-8.mol |  |
| | Terbinafine DiMer IMpurity Chemical Properties |
| Melting point | 154-156°C (dec.) | | Boiling point | 654.2±55.0 °C(Predicted) | | density | 1.071±0.06 g/cm3(Predicted) | | storage temp. | Amber Vial, -20°C Freezer | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 7.36±0.50(Predicted) | | color | White to Off-White | | InChIKey | YZZQDUPUWRZTLM-YQGGXCSUSA-N | | SMILES | C(N(C)CC1=C2C(C=CC=C2)=CC=C1)/C=C/C(=C\C#CC(C)(C)C)/CN(C)CC1=C2C(C=CC=C2)=CC=C1 |
| | Terbinafine DiMer IMpurity Usage And Synthesis |
| Uses | A dimeric impurity of the antifungal agent Terbinafine (T107500). | | Uses | A Terbinafine dimeric impurity of the antifungal agent Terbinafine (T107500), an orally active, antimycotic allylamine related to Naftifine. A specfic inhibitor of squalene epoxidase, a key enzyme in fungal ergosterol biosynthesis. Antifungal. Also an impurity of SF 86-327 an antimycotic agent (2). |
| | Terbinafine DiMer IMpurity Preparation Products And Raw materials |
|