|
|
| | Methyl 1-phenylcyclopropanecarboxylate Basic information |
| Product Name: | Methyl 1-phenylcyclopropanecarboxylate | | Synonyms: | Methyl 1-phenylcyclopropanecarboxylate;1-Phenylcyclopropanecarboxylic acid methyl ester;Methyl 1-phenylcyclopropane-1-carboxylate;CYCLOPROPANECARBOXYLIC ACID, 1-PHENYL-, METHYL ESTER;Methyl 1-phenylcyclopropan-carboxylate | | CAS: | 6121-42-2 | | MF: | C11H12O2 | | MW: | 176.21 | | EINECS: | | | Product Categories: | | | Mol File: | 6121-42-2.mol |  |
| | Methyl 1-phenylcyclopropanecarboxylate Chemical Properties |
| Boiling point | 244℃ | | density | 1.148 | | Fp | 93℃ | | storage temp. | Store at room temperature | | form | solid | | Appearance | Colorless to light yellow Liquid | | InChI | 1S/C11H12O2/c1-13-10(12)11(7-8-11)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 | | InChIKey | MVHLBUKYYVVZMF-UHFFFAOYSA-N | | SMILES | O=C(OC)C1(C2=CC=CC=C2)CC1 |
| WGK Germany | WGK 3 | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Methyl 1-phenylcyclopropanecarboxylate Usage And Synthesis |
| | Methyl 1-phenylcyclopropanecarboxylate Preparation Products And Raw materials |
|