|
|
| | 4-BENZYLOXYPHENYLACETIC ACID Basic information |
| | 4-BENZYLOXYPHENYLACETIC ACID Chemical Properties |
| Melting point | 119-123 °C (lit.) | | Boiling point | 418.8±25.0 °C(Predicted) | | density | 1.201±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.44±0.10(Predicted) | | form | Crystalline Powder | | color | White | | Water Solubility | 89.9mg/L(25 ºC) | | InChI | InChI=1S/C15H14O3/c16-15(17)10-12-6-8-14(9-7-12)18-11-13-4-2-1-3-5-13/h1-9H,10-11H2,(H,16,17) | | InChIKey | XJHGAJLIKDAOPE-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC=C(OCC2=CC=CC=C2)C=C1 | | CAS DataBase Reference | 6547-53-1(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Benzyloxyphenyl acetic acid(6547-53-1) |
| Hazard Codes | Xi,Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29189900 | | Storage Class | 13 - Non Combustible Solids |
| | 4-BENZYLOXYPHENYLACETIC ACID Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | 4-Benzyloxyphenylacetic Acid is an effective inflammation inhibitor. | | General Description | (4-Benzyloxy)phenylacetic acid is a para-substituted phenyl-acetic acid derivative. Its crystals belong to the triclinic crystal system. Molecules of (4-benzyloxy)phenylacetic acid exists in centrosymmetric dimeric forms linked by double hydrogen bonds between carboxyl groups. |
| | 4-BENZYLOXYPHENYLACETIC ACID Preparation Products And Raw materials |
|