- FMOC-CYS(TRT)-OPFP
-
- $1.00 / 1KG
-
2019-07-06
- CAS:115520-21-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | FMOC-CYS(TRT)-OPFP Basic information |
| | FMOC-CYS(TRT)-OPFP Chemical Properties |
| Melting point | 71-73 °C | | Boiling point | 803.5±65.0 °C(Predicted) | | density | 1.359±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 10.09±0.46(Predicted) | | form | Solid | | BRN | 4225739 | | Major Application | peptide synthesis | | InChIKey | FDAUCYDVXIPBDR-UMSFTDKQSA-N | | SMILES | Fc1c(F)c(F)c(OC(=O)[C@H](CSC(c2ccccc2)(c3ccccc3)c4ccccc4)NC(=O)OCC5c6ccccc6-c7ccccc57)c(F)c1F |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2930 90 16 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Irrit. 2 |
| | FMOC-CYS(TRT)-OPFP Usage And Synthesis |
| Uses | Fmoc-cys(pmeobzl)-oh is used as a reactant in peptide synthesis. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-CYS(TRT)-OPFP Preparation Products And Raw materials |
|