|
|
| | bicyclo[1.1.1]pentan-3-amine,hydrochloride Basic information |
| Product Name: | bicyclo[1.1.1]pentan-3-amine,hydrochloride | | Synonyms: | bicyclo[1.1.1]pentan-3-amine,hydrochloride;1-aminobicyclo<1.1.1>pentane hydrochloride;Bicyclo[1.1.1]pentan-1-amine, hydrochloride (1:1);Propellamine HCl;Bicyclo[1.1.1]pent-1-ylamine hydrochloride;EOS-60771;BICYCLO[1.1.1]PENTAN-1-AMINE HYDROCHORIDE;bicyclo[1.1.1]pentan-3-amine | | CAS: | 22287-35-0 | | MF: | C5H9N | | MW: | 83.13166 | | EINECS: | | | Product Categories: | organic building block | | Mol File: | 22287-35-0.mol | ![bicyclo[1.1.1]pentan-3-amine,hydrochloride Structure](CAS/GIF/22287-35-0.gif) |
| | bicyclo[1.1.1]pentan-3-amine,hydrochloride Chemical Properties |
| Melting point | 242-244 °C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | Water Solubility | Soluble in water | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C5H9N.ClH/c6-5-1-4(2-5)3-5;/h4H,1-3,6H2;1H | | InChIKey | LQKLVOWNBKJRJE-UHFFFAOYSA-N | | SMILES | NC12CC(C1)C2.Cl |
| WGK Germany | WGK 3 | | HS Code | 29213000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | bicyclo[1.1.1]pentan-3-amine,hydrochloride Usage And Synthesis |
| Uses | - 1-Bicyclo[1.1.1]pentylamine hydrochloride can be used to synthesize bisbicyclo[1.1.1]pentyldiazene.
- It is used as a precursor in the synthesis of a potent quinolone antibacterial agent, U-87947E.
- It can also be used to prepare bicyclo[1.1.1]pentane-derived azides for click chemistry applications.
|
| | bicyclo[1.1.1]pentan-3-amine,hydrochloride Preparation Products And Raw materials |
|