- 1-BROMO-2-FLUORO-4-IODOBENZENE
-
- $100.00 / 1KG
-
2025-09-25
- CAS:136434-77-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 1-BROMO-2-FLUORO-4-IODOBENZENE Basic information |
| | 1-BROMO-2-FLUORO-4-IODOBENZENE Chemical Properties |
| Melting point | 34-38 °C(lit.) | | Boiling point | 80°C 2,5mm | | density | 2.2691 (estimate) | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Crystalline Low Melting Solid | | color | Pale brown | | Sensitive | Light Sensitive | | BRN | 4740251 | | InChI | InChI=1S/C6H3BrFI/c7-5-2-1-4(9)3-6(5)8/h1-3H | | InChIKey | OCODJNASCDFXSR-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(I)C=C1F | | CAS DataBase Reference | 136434-77-0(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-52/53-36/37/38 | | Safety Statements | 36-37/39-26-24/25 | | WGK Germany | 2 | | Hazard Note | Irritant/Light Sensitive | | HazardClass | IRRITANT, LIGHT SENSITIVE | | HS Code | 29039990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1-BROMO-2-FLUORO-4-IODOBENZENE Usage And Synthesis |
| Chemical Properties | Pale brown crystalline low melting solid | | Uses | 1-Bromo-2-fluoro-4-iodobenzene is a imidazole compounds, used as a drug heterocyclic building block. | | Synthesis | 1-Bromo-2-fluoro-4-iodobenzene can be prepared from the diazotization reaction of 2-fluoro-4-iodoaniline. |
| | 1-BROMO-2-FLUORO-4-IODOBENZENE Preparation Products And Raw materials |
|