| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
|
| | (5-Cyclopropyl-3-(2,6-dichlorophenyl)isoxazol-4-yl)methanol Basic information | | Application |
| Product Name: | (5-Cyclopropyl-3-(2,6-dichlorophenyl)isoxazol-4-yl)methanol | | Synonyms: | 4-IsoxazoleMethanol, 5-cyclopropyl-3-(2,6-dichlorophenyl)-;5-cyclopropyl-3-(2,6-dichlorophenyl)-4-Isoxazolemethanol;[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methanol;(5-CYCLOPROPYL-3-(2,6-DICHLOROPHENYL)ISOXAZOL-4-YL)METHANOL(WXG03483);CYCLOPROPYL-3-(2,6-DICHLOROPHENYL)ISOXAZOL-4-YL)METHANOL;4-(hydroxymethyl)-5-cyclopropyl-3-(2,6-dichlorophenyl)isoxazole;5-Cyclopropyl-3-(2,6-dichlorophenyl)isoxazole-4-methanol;2-oxazol-4-yl]methanol | | CAS: | 946426-89-7 | | MF: | C13H11Cl2NO2 | | MW: | 284.14 | | EINECS: | | | Product Categories: | Research | | Mol File: | 946426-89-7.mol |  |
| | (5-Cyclopropyl-3-(2,6-dichlorophenyl)isoxazol-4-yl)methanol Chemical Properties |
| Boiling point | 441.2±45.0 °C(Predicted) | | density | 1.446±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 13.22±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C13H11Cl2NO2/c14-9-2-1-3-10(15)11(9)12-8(6-17)13(18-16-12)7-4-5-7/h1-3,7,17H,4-6H2 | | InChIKey | KRGFOUGVZFEEBW-UHFFFAOYSA-N | | SMILES | O1C(C2CC2)=C(CO)C(C2=C(Cl)C=CC=C2Cl)=N1 |
| | (5-Cyclopropyl-3-(2,6-dichlorophenyl)isoxazol-4-yl)methanol Usage And Synthesis |
| Application | [5-Cyclopropyl-3-(2,6-Dichlorophenyl)-4-Isooxazolyl]methanol can be used as an organic intermediate and pharmaceutical intermediate, mainly in laboratory research and development processes and chemical and pharmaceutical analysis processes. |
| | (5-Cyclopropyl-3-(2,6-dichlorophenyl)isoxazol-4-yl)methanol Preparation Products And Raw materials |
|