|
|
| | Albuterol diMer Basic information |
| Product Name: | Albuterol diMer | | Synonyms: | 2,2'-Oxybis(methylene)bis{4-[2-(tert-butylamino)-1-hydroxyethyl]phenol} diacetate;3,3'-[Oxybis(Methylene)]bis[α-[[(1,1-diMethylethyl)aMino]Methyl]-4-hydroxybenzeneMethanol;Albuterol DiMer Ether;Albuterol IMpurity F;SalbutaMol DiMer Ether;1,1'-((oxybis(methylene))bis(4-hydroxy-3,1-phenylene))bis(2-(tert-butylamino)ethanone);Salbutamol Impurity 6（Salbutamol EP Impurity F）;Salbutamol EP Imp F | | CAS: | 147663-30-7 | | MF: | C26H40N2O5 | | MW: | 460.61 | | EINECS: | 604-604-1 | | Product Categories: | Amines;Aromatics;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 147663-30-7.mol |  |
| | Albuterol diMer Chemical Properties |
| Boiling point | 644.5±50.0 °C(Predicted) | | density | 1.157±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Methanol (Slightly) | | form | Solid | | pka | 9.13±0.50(Predicted) | | color | Tan | | InChI | InChI=1S/C26H40N2O5/c1-25(2,3)27-14-22(31)16-8-10-20(29)18(12-16)24(33-7)19-13-17(9-11-21(19)30)23(32)15-28-26(4,5)6/h8-13,22-24,27-32H,14-15H2,1-7H3 | | InChIKey | KIHLBFTYTAQOGO-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(C(O)CNC(C)(C)C)C=C1C(C1=CC(C(O)CNC(C)(C)C)=CC=C1O)OC |
| | Albuterol diMer Usage And Synthesis |
| Uses | Albuterol Dimer Ether (Salbutamol EP Impurity F) is an impurity of Albuterol (Salbutamol) (A514500). Albuterol impurity F. |
| | Albuterol diMer Preparation Products And Raw materials |
|