- Gliquidone Impurity 13
-
- $0.00 / 5mg
-
2025-12-19
- CAS:55974-25-9
- Min. Order: 5mg
- Purity: 95%+
- Supply Ability: 1000mg
|
| | 7-Methoxy-4,4-dimethyl-1H-2-benzopyran-1,3(4H)-dione Basic information |
| Product Name: | 7-Methoxy-4,4-dimethyl-1H-2-benzopyran-1,3(4H)-dione | | Synonyms: | 7-Methoxy-4,4-dimethyl-1,3-isochromandione;7-Methoxy-4,4-dimethyl-1H-2-benzopyran-1,3(4H)-dione;7-Methoxy-4,4-diMethylisochroMan-1,3-dione;7-methoxy-4,4-dimethylisochromene-1,3-dione;7-methoxy-4,4-dimethyl-3,4-dihydro-1H-2-benzopyran-1,3-dione;1H-2-Benzopyran-1,3(4H)-dione, 7-methoxy-4,4-dimethyl-;Gliquidone Impurity 9;7-Methoxy-4,4-dimethylisochromane-1,3-dione | | CAS: | 55974-25-9 | | MF: | C12H12O4 | | MW: | 220.22 | | EINECS: | 611-342-0 | | Product Categories: | | | Mol File: | 55974-25-9.mol |  |
| | 7-Methoxy-4,4-dimethyl-1H-2-benzopyran-1,3(4H)-dione Chemical Properties |
| Boiling point | 366.9±42.0 °C(Predicted) | | density | 1.205 | | storage temp. | 2-8°C | | InChI | InChI=1S/C12H12O4/c1-12(2)9-5-4-7(15-3)6-8(9)10(13)16-11(12)14/h4-6H,1-3H3 | | InChIKey | XAFPBWJMFWANOI-UHFFFAOYSA-N | | SMILES | C1(=O)OC(=O)C2=CC(OC)=CC=C2C1(C)C |
| | 7-Methoxy-4,4-dimethyl-1H-2-benzopyran-1,3(4H)-dione Usage And Synthesis |
| | 7-Methoxy-4,4-dimethyl-1H-2-benzopyran-1,3(4H)-dione Preparation Products And Raw materials |
|