|
|
| | 1-Adamantyl methyl ketone Basic information |
| | 1-Adamantyl methyl ketone Chemical Properties |
| Melting point | 53-55 °C (lit.) | | Boiling point | 250.52°C (rough estimate) | | density | 0.9172 (rough estimate) | | refractive index | 1.5050 (estimate) | | Fp | 227 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Crystalline Powder | | color | White | | Water Solubility | Soluble in methanol- very faint turbidity. Insoluble in water. | | InChI | InChI=1S/C12H18O/c1-8(13)12-5-9-2-10(6-12)4-11(3-9)7-12/h9-11H,2-7H2,1H3 | | InChIKey | DACIGVIOAFXPHW-UHFFFAOYSA-N | | SMILES | C(=O)(C12CC3CC(CC(C3)C1)C2)C | | CAS DataBase Reference | 1660-04-4(CAS DataBase Reference) | | NIST Chemistry Reference | 1-Adamantyl methyl ketone(1660-04-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36-26 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29142990 | | Storage Class | 11 - Combustible Solids |
| | 1-Adamantyl methyl ketone Usage And Synthesis |
| Chemical Properties | WHITE CRYSTALLINE POWDER | | Uses | 1-Adamantyl methyl ketone, is used as an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff. | | General Description | 1-Adamantyl methyl ketone, a sterically bulky ketone substrate, was reduced to the corresponding alcohol with excellent optical purity. |
| | 1-Adamantyl methyl ketone Preparation Products And Raw materials |
|