| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | 1H-Indole, 4-fluoro-5-nitro- Basic information |
| | 1H-Indole, 4-fluoro-5-nitro- Chemical Properties |
| Boiling point | 379.6±22.0 °C(Predicted) | | density | 1.527±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 14.65±0.30(Predicted) | | Appearance | White to yellow Solid | | InChI | InChI=1S/C8H5FN2O2/c9-8-5-3-4-10-6(5)1-2-7(8)11(12)13/h1-4,10H | | InChIKey | UTYWHDIQWCMUNW-UHFFFAOYSA-N | | SMILES | N1C2=C(C(F)=C([N+]([O-])=O)C=C2)C=C1 |
| | 1H-Indole, 4-fluoro-5-nitro- Usage And Synthesis |
| | 1H-Indole, 4-fluoro-5-nitro- Preparation Products And Raw materials |
|