| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:N-(5-Chloro-2,1,3-benzothiadiazol-4-yl)-thiourea CAS:51323-05-8 Package:500Mg,50Mg
|
|
| | N-(5-Chloro-2,1,3-benzothiadiazol-4-yl)thiourea Basic information |
| Product Name: | N-(5-Chloro-2,1,3-benzothiadiazol-4-yl)thiourea | | Synonyms: | (5-Chloro-2,1,3-benzothiadiazol-4-yl)-thiourea;Tizanidine EP Impurity B;Tizanidine Impurity 2(Tizanidine EP Impurity B);N-(5-Chloro-2,1,3-benzothiadiazol-4-yl)thiourea;Thiourea, N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-;1-(5-Chlorobenzo[c][1,2,5]thiadiazol-4-yl)thiourea | | CAS: | 51323-05-8 | | MF: | C7H5ClN4S2 | | MW: | 244.72 | | EINECS: | | | Product Categories: | Amines;Aromatics;Heterocycles;Sulfur & Selenium Compounds | | Mol File: | 51323-05-8.mol |  |
| | N-(5-Chloro-2,1,3-benzothiadiazol-4-yl)thiourea Chemical Properties |
| Melting point | 176 - 178°C | | density | 1.753 | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Dark Yellow to Dark Orange | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C7H5ClN4S2/c8-3-1-2-4-6(12-14-11-4)5(3)10-7(9)13/h1-2H,(H3,9,10,13) | | InChIKey | HDSZYIYKDOIGFC-UHFFFAOYSA-N | | SMILES | [s]1nc2c(n1)ccc(c2NC(=S)N)Cl |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | N-(5-Chloro-2,1,3-benzothiadiazol-4-yl)thiourea Usage And Synthesis |
| Chemical Properties | Dark Yellow to Orange Solid | | Uses | N-(5-Chloro-2,1,3-benzothiadiazol-4-yl)-thiourea (Tizanidine EP Impurity B) is a Tizanidine (T449500) impurity. |
| | N-(5-Chloro-2,1,3-benzothiadiazol-4-yl)thiourea Preparation Products And Raw materials |
|