| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:(?)-trans-Pinocarveol
CAS:547-61-5
Purity:>=96.0% (suM of enantioMers, GC) Package:1ML
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(-)-trans-Pinocarveol
CAS:547-61-5
Purity:>=96.0% (sum of enantiomers, GC) Package:1ML Remarks:80613-1ML
|
| Company Name: |
Shaanxi DIDU pharmaceutical and Chemical Co., Ltd
|
| Tel: |
029-029-81120477 17792793610 |
| Email: |
1033@dideu.com |
| Products Intro: |
Product Name:[1S-(1,3,5)]-6,6-dimethyl-2-methylenebicyclo[3.1.1]heptan-3-ol
CAS:547-61-5
Purity:98% HPLC Package:25KG;1KG
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:()-trans-Pinocarveol
CAS:547-61-5
|
|
| | (-)-TRANS-PINOCARVEOL Basic information |
| Product Name: | (-)-TRANS-PINOCARVEOL | | Synonyms: | (1S,3R,5S)-6,6-DIMETHYL-2-METHYLENEBICYCLO[3.1.1]HEPTAN-3-OL;[1S-(1alpha,3alpha,5alpha)]-6,6-dimethyl-2-methylenebicyclo[3.1.1]heptan-3-ol;(-)-TRANS-PINOCARVEOL 96+%;(1S,3R,5S)-2-Methylene-6,6-dimethylbicyclo[3.1.1]heptane-3-ol;(1S,5S)-6,6-Dimethyl-2-methylenebicyclo[3.1.1]heptan-3α-ol;[1S,3R,5S,(-)]-Pin-2(10)-en-3-ol;(1S,5S)-6,6-dimethyl-2-methylene-norpinan-3-ol;(1S,5S)-7,7-dimethyl-4-methylidene-bicyclo[3.1.1]heptan-3-ol | | CAS: | 547-61-5 | | MF: | C10H16O | | MW: | 152.23 | | EINECS: | 208-927-4 | | Product Categories: | | | Mol File: | 547-61-5.mol |  |
| | (-)-TRANS-PINOCARVEOL Chemical Properties |
| Melting point | 5 °C | | Boiling point | 97-98 °C(Press: 12 Torr) | | density | 0.979 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.500 | | form | liquid | | pka | 14.91±0.40(Predicted) | | color | milky white | | Odor | at 100.00 %. warm woody balsamic fennel | | Odor Type | woody | | Optical Rotation | [α]20/D 72±3°, neat | | BRN | 5730571 | | InChI | 1S/C10H16O/c1-6-8-4-7(5-9(6)11)10(8,2)3/h7-9,11H,1,4-5H2,2-3H3/t7-,8+,9+/m0/s1 | | InChIKey | LCYXQUJDODZYIJ-DJLDLDEBSA-N | | SMILES | CC1(C)[C@@H]2C[C@@H](O)C(=C)[C@H]1C2 | | LogP | 2.379 (est) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | F | 9-23 | | Storage Class | 12 - Non Combustible Liquids |
| | (-)-TRANS-PINOCARVEOL Usage And Synthesis |
| Uses | (-)-trans-Pinocarveol is an allyl alcohol. It is formed during the allylic oxidation of β-pinene using hydrogen peroxide-selenium dioxide or from the isomerization of α-pinene oxide over zirconium oxide. | | Definition | ChEBI: (-)-trans-pinocarveol is the (1S,3R,5S)-stereoisomer of pinocarveol. | | General Description | (-)-trans-Pinocarveol is an allyl alcohol. It is formed during the allylic oxidation of β-pinene using hydrogen peroxide-selenium dioxide or from the isomerization of α-pinene oxide over zirconium oxide. |
| | (-)-TRANS-PINOCARVEOL Preparation Products And Raw materials |
|