1,4-Phenylenebis[tributylstannane] manufacturers
|
| | 1,4-Phenylenebis[tributylstannane] Basic information |
| Product Name: | 1,4-Phenylenebis[tributylstannane] | | Synonyms: | 1,4-Bis(tributylstannanyl)benzene;1,4-Bis(tributylstannyl)benzene;1,4-Phenylenebis[tributylstannane];Phenylene-1,4-bis(tributylstannane), Benzene-1,4-diylbis(tributylstannane);tributyl-(4-tributylstannylphenyl)stannane;Stannane, 1,1'-(1,4-phenylene)bis[1,1,1-tributyl-;SKL1098;ributyl-(4-tributylstannylphenyl)stannane | | CAS: | 17151-51-8 | | MF: | C30H58Sn2 | | MW: | 656.2 | | EINECS: | | | Product Categories: | Chemical Synthesis;Organometallic Reagents;Organotin;Organotins | | Mol File: | 17151-51-8.mol | ![1,4-Phenylenebis[tributylstannane] Structure](CAS/GIF/17151-51-8.gif) |
| | 1,4-Phenylenebis[tributylstannane] Chemical Properties |
| Boiling point | 206-210 °C(Press: 0.04 Torr) | | density | 1.147g/mLat 25℃ | | refractive index | n20/D 1.522 | | Fp | >110°C | | storage temp. | Storage temp. -20°C | | form | liquid | | color | Clear | | InChI | 1S/C6H4.6C4H9.2Sn/c1-2-4-6-5-3-1;6*1-3-4-2;;/h1-2,5-6H;6*1,3-4H2,2H3;; | | InChIKey | RZCMLHJDBZGVSJ-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(cc1)[Sn](CCCC)(CCCC)CCCC |
| Hazard Codes | T,N | | Risk Statements | 21-25-36/38-48/23/25-50/53 | | Safety Statements | 35-36/37/39-45-60-61 | | RIDADR | UN 2788 6.1/PG 3 | | WGK Germany | 3 | | HS Code | 2850002090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Repr. 1B
Skin Irrit. 2
STOT RE 1 |
| | 1,4-Phenylenebis[tributylstannane] Usage And Synthesis |
| Uses | Reactant for:• ;Preparation of covalent analogs of DNA base pairs and triplets from 9-benzyl-6-chloropurine via a Stille cross-coupling reaction1• ;Reaction with glucuronolactone derivatives in preparation of 3-C-iodomethyl, 6-C-iodomethyl and 6-C-iodophenyl derivatives as higher iodinated analogs of D-glucose2 | | Uses | Reactant for:
- Preparation of covalent analogs of DNA base pairs and triplets from 9-benzyl-6-chloropurine via a Stille cross-coupling reaction
- Reaction with glucuronolactone derivatives in preparation of 3-C-iodomethyl, 6-C-iodomethyl and 6-C-iodophenyl derivatives as higher iodinated analogs of D-glucose
|
| | 1,4-Phenylenebis[tributylstannane] Preparation Products And Raw materials |
|