| Company Name: |
ChemShuttle, Inc. |
| Tel: |
0510-83588313-811 18800520310 |
| Email: |
sales@chemshuttle.com |
|
| | CarbaMic acid, N-(4-broMo-2-nitrophenyl)-, 1,1-diMethylethyl ester Basic information |
| | CarbaMic acid, N-(4-broMo-2-nitrophenyl)-, 1,1-diMethylethyl ester Chemical Properties |
| Boiling point | 337.8±32.0 °C(Predicted) | | density | 1.535±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform, Dichloromethane, Methanol | | pka | 11.70±0.70(Predicted) | | form | Solid | | color | Yellow | | InChI | InChI=1S/C11H13BrN2O4/c1-11(2,3)18-10(15)13-8-5-4-7(12)6-9(8)14(16)17/h4-6H,1-3H3,(H,13,15) | | InChIKey | VALNWXMPJVPVLQ-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NC1=CC=C(Br)C=C1[N+]([O-])=O |
| | CarbaMic acid, N-(4-broMo-2-nitrophenyl)-, 1,1-diMethylethyl ester Usage And Synthesis |
| Chemical Properties | Yellow Solid | | Uses | tert-butyl N-(4-bromo-2-nitrophenyl)carbamate is a reactant used in the optimization of selective HDAC1/HDAC2 inhibitor and preparation of selective HDAC inhibitors. |
| | CarbaMic acid, N-(4-broMo-2-nitrophenyl)-, 1,1-diMethylethyl ester Preparation Products And Raw materials |
|