|
|
| Product Name: | VD3-D6 | | Synonyms: | VD3-D6;(1S,3Z)-4-methylene-3-[(2E)-2-[(1R,3aS,7aR)-octahydro-7a-methyl-1-[(1R)-1-methyl-5-(methyl-d3)hexyl-6,6,6-d3]-4H-inden-4-ylidene]ethylidene]- Cyclohexanol;Cholecalciferol, vit D3-d6;(1S,3Z)-4-methylene-3-[(2E)-2-[(1R,3aS,7aR)-octahydro-7a-methyl-1-[(1R)-1-methyl-5-(methyl-d3)hexyl-6,6,6-d3]-4H-inden-4-ylidene]ethylidene]cyclohexanol;Cholecalciferol-d6;Vitamin D3-26,26,26,27,27,27-d6;Vitamin D3-d6;(1S,3Z)-3-[(2E)-2-[(1R,3aS,7aR)-7a-methyl-1-[(2R)-7,7,7-trideuterio-6-(trideuteriomethyl)heptan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol | | CAS: | 118584-54-6 | | MF: | C27H38D6O | | MW: | 390.68 | | EINECS: | | | Product Categories: | | | Mol File: | 118584-54-6.mol |  |
| | VD3-D6 Chemical Properties |
| Boiling point | 496.445±24.00 °C(Press: 760.00 Torr)(predicted) | | density | 0.969±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Store at -20°C,unstable in solution, ready to use. | | solubility | Soluble in DMSO | | form | Powder | | pka | 14.742±0.20(predicted) | | color | White to light yellow | | InChIKey | QYSXJUFSXHHAJI-WXIRDHBANA-N | | SMILES | [C@H]1(O)CCC(=C)/C(=C\C=C2/CCC[C@@]3(C)[C@@]/2([H])CC[C@@H]3[C@@H](CCCC(C([2H])([2H])[2H])C([2H])([2H])[2H])C)/C1 |&1:0,13,15,19,20,r| |
| | VD3-D6 Usage And Synthesis |
| Uses | Isotope labelled vitamin d3, the vitamin that mediates intestinal calcium absorbtion, bone calcium metabolism and probably, muscle activity. Occurs in and is isolated from fish liver oils. Vitamin D acts through a receptor that is a member of the ligand-dependent transcription factor superfamily. Modulates the proliferation and differentiation of both normal and cancer cells. Has antiproliferative and antimetastatic effects on breast, colon, and prostate cancer cells. Activated vitamin D receptors in intestine and bone maintain calcium absorbance and homeostasis. |
| | VD3-D6 Preparation Products And Raw materials |
|