| Company Name: |
Parry Technology Co., Ltd Gold
|
| Tel: |
0310-7183478 13612179565 |
| Email: |
gjw0401@126.com |
| Products Intro: |
Product Name:ETHYL ACETATE CAS:117121-81-0 Purity:99.0%D,98.0% Package:25G;100G;500G;1KG;5KG;25KG;100KG;
|
|
| | ETHYL-D5 ACETATE-D3 Basic information |
| Product Name: | ETHYL-D5 ACETATE-D3 | | Synonyms: | ETHYL-D5 ACETATE-D3;ETHYL ACETATE-D8;ETHYL-D5 ACETATE-D3, 99.5 ATOM% D;Ethyl acetate-d8 99.5 atom % D, 99% (CP);ETHYL ACETATE (D8, 99.5%);Ethyl acetate-d8 99.5 Atom % D;ETHYL ACETATE (D8, 99%);Acetic-2,2,2-d3 acid, ethyl-1,1,2,2,2-d5 ester | | CAS: | 117121-81-0 | | MF: | C4D8O2 | | MW: | 96.15 | | EINECS: | | | Product Categories: | | | Mol File: | 117121-81-0.mol |  |
| | ETHYL-D5 ACETATE-D3 Chemical Properties |
| Melting point | -84 °C(lit.) | | Boiling point | 77 °C(lit.) | | density | 0.984 g/mL at 25 °C | | refractive index | n20/D 1.369(lit.) | | Fp | -3 °C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Liquid | | color | Colourless | | Stability: | Volatile | | InChI | InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3/i1D3,2D3,3D2 | | InChIKey | XEKOWRVHYACXOJ-AUOAYUKBSA-N | | SMILES | O(C([2H])([2H])C([2H])([2H])[2H])C(=O)C([2H])([2H])[2H] | | CAS Number Unlabeled | 141-78-6 |
| Hazard Codes | F,Xi | | Risk Statements | 36/37/38-67-66-36-11 | | Safety Statements | 16-26-36/37/39-33 | | RIDADR | UN 1173 3/PG 2 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |
| | ETHYL-D5 ACETATE-D3 Usage And Synthesis |
| Uses | Ethyl acetate-d8 was used as one of the analytical standards during the quantification of volatile components present in extra virgin olive oil (EVOO) samples. | | General Description | Ethyl acetate-d8 is a deuterated NMR solvent useful in NMR-based research and analyses. |
| | ETHYL-D5 ACETATE-D3 Preparation Products And Raw materials |
|