| Company Name: |
Beijing Ouhe Technology Co., Ltd
|
| Tel: |
13552068683 13522913783 |
| Email: |
2355560935@qq.com |
| Products Intro: |
Product Name:2-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)propan-2-ol
CAS:1309980-11-7
Purity:98% Package:5g;250mg;1g
|
| Company Name: |
Shanghai Topbiochem Technology Co., Ltd
|
| Tel: |
021-58170097 |
| Email: |
info@topbiochem.com |
| Products Intro: |
Product Name:2-(3-(4,4,5,5-TetraMethyl-1,3,2-dioxaborolan-2-yl)phenyl)propan-2-ol
CAS:1309980-11-7
Purity:98% Package:10g;100g;1kg
|
|
| | 2-(3-(4,4,5,5-TetraMethyl-1,3,2-dioxaborolan-2-yl)phenyl)propan-2-ol Basic information |
| Product Name: | 2-(3-(4,4,5,5-TetraMethyl-1,3,2-dioxaborolan-2-yl)phenyl)propan-2-ol | | Synonyms: | 2-(3-(4,4,5,5-TetraMethyl-1,3,2-dioxaborolan-2-yl)phenyl)propan-2-ol;3-(2-Hydroxypropan-2-yl)phenylboronic acid pinacol ester;3-(2-Hydroxy-2-propyl)phenylboronic Acid Pinacol Ester;Benzenemethanol, α,α-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;Benzenemethanol,α,α-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- | | CAS: | 1309980-11-7 | | MF: | C15H23BO3 | | MW: | 262.15 | | EINECS: | | | Product Categories: | | | Mol File: | 1309980-11-7.mol |  |
| | 2-(3-(4,4,5,5-TetraMethyl-1,3,2-dioxaborolan-2-yl)phenyl)propan-2-ol Chemical Properties |
| Melting point | 64-69°C | | Boiling point | 374.5±25.0 °C(Predicted) | | density | 1.04±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | pka | 14.48±0.29(Predicted) | | Appearance | White to off-white Solid | | InChI | 1S/C15H23BO3/c1-13(2,17)11-8-7-9-12(10-11)16-18-14(3,4)15(5,6)19-16/h7-10,17H,1-6H3 | | InChIKey | NNPQWBXXZHNLAW-UHFFFAOYSA-N | | SMILES | CC(C)(O)c1cccc(c1)B2OC(C)(C)C(C)(C)O2 |
| WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | 2-(3-(4,4,5,5-TetraMethyl-1,3,2-dioxaborolan-2-yl)phenyl)propan-2-ol Usage And Synthesis |
| Uses | 3-(2-Hydroxy-2-propanyl)phenylboronic acid pinacol ester can be used as an intermediate in the synthesis of furo[3,2-b]pyridine derivatives as potent kinase inhibitors. |
| | 2-(3-(4,4,5,5-TetraMethyl-1,3,2-dioxaborolan-2-yl)phenyl)propan-2-ol Preparation Products And Raw materials |
|