| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4,4′-Bis(MercaptoMethyl)biphenyl Basic information | | Uses |
| Product Name: | 4,4′-Bis(MercaptoMethyl)biphenyl | | Synonyms: | 4,4'-Bis(mercaptomethyl)biphenyl 97%;4,4′-Bis(MercaptoMethyl)biphenyl;[4-[4-(sulfanylmethyl)phenyl]phenyl]methanethiol;[1,1'-Biphenyl]-4,4'-dimethanethiol;4,4'-Bis(mercaptomethyl)biphenyl;1,1'-biphenyl]-4,4'-diyldimethanethiol | | CAS: | 43012-19-7 | | MF: | C14H14S2 | | MW: | 246.39 | | EINECS: | | | Product Categories: | | | Mol File: | 43012-19-7.mol |  |
| | 4,4′-Bis(MercaptoMethyl)biphenyl Chemical Properties |
| Melting point | 148-152°C | | Boiling point | 410.0±40.0 °C(Predicted) | | density | 1.143±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 9.31±0.10(Predicted) | | form | solid | | InChI | 1S/C14H14S2/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8,15-16H,9-10H2 | | InChIKey | XFHIDPOTWOFDEM-UHFFFAOYSA-N | | SMILES | SCc1ccc(cc1)-c2ccc(CS)cc2 |
| Hazard Codes | Xi,N | | Risk Statements | 36-50/53 | | Safety Statements | 26-60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 2 | | HS Code | 2930909899 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2 |
| | 4,4′-Bis(MercaptoMethyl)biphenyl Usage And Synthesis |
| Uses | 4,4′-bis(mercaptomethyl)biphenyl can be used to prepare polysulfides by high-temperature solution polycondensation with aliphatic and aromatic-aliphatic dihalogenated hydrocarbons. |
| | 4,4′-Bis(MercaptoMethyl)biphenyl Preparation Products And Raw materials |
|