N-ForMylsaccharin manufacturers
- N-ForMylsaccharin
-
- $0.00 / 25kg
-
2025-12-01
- CAS:50978-45-5
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
- N-ForMylsaccharin
-
- $0.00 / 1KG
-
2025-09-23
- CAS:50978-45-5
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 2000
|
| | N-ForMylsaccharin Basic information |
| Product Name: | N-ForMylsaccharin | | Synonyms: | N-Formylsaccharin;N-ForMylsaccharin;1,1,3-TRIOXO-1,2-BENZOTHIAZOLE-2-CARBALDEHYDE;3-Oxobenzo[d]isothiazole-2(3H)-carbaldehyde 1,1-dioxide;N-Formylsaccharin>;1,2-Benzisothiazole-2(3H)-carboxaldehyde, 3-oxo-, 1,1-dioxide;3-oxybenzenebenzo[d]isothiazole-2(3H)-methylaldehyde1,1-dioxy | | CAS: | 50978-45-5 | | MF: | C8H5NO4S | | MW: | 211.19 | | EINECS: | | | Product Categories: | | | Mol File: | 50978-45-5.mol |  |
| | N-ForMylsaccharin Chemical Properties |
| Boiling point | 418.3±28.0 °C(Predicted) | | density | 1.771±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DCM | | form | Solid | | pka | -21.17±0.20(Predicted) | | color | White | | InChI | InChI=1S/C8H5NO4S/c10-5-9-8(11)6-3-1-2-4-7(6)14(9,12)13/h1-5H | | InChIKey | LMPIFZSJKLLOLM-UHFFFAOYSA-N | | SMILES | S1(=O)(=O)C2=C(C=CC=C2)C(=O)N1C=O |
| | N-ForMylsaccharin Usage And Synthesis |
| Uses | N-Formylsaccharin is an reagent that was shown to be efficient at chemoselective N-formylation of both primary and secondary amines. |
| | N-ForMylsaccharin Preparation Products And Raw materials |
|