|
|
| | Methyl 3,4,5-trimethoxybenzoate Basic information |
| Product Name: | Methyl 3,4,5-trimethoxybenzoate | | Synonyms: | Benzoic acid, 3,4,5-trimethoxy, methyl ester;Methyl gallate trimethyl ether;3,4,5-Trimethoxy-benzoesre-methylester;Methyl EudesMate;NSC 16955;TriMethopriM IMpurity H;3,4,5-trimethoxy-2-methylbenzoate;METHYL 3,4,5-TRIMETHOXYB | | CAS: | 1916-07-0 | | MF: | C11H14O5 | | MW: | 226.23 | | EINECS: | 217-629-3 | | Product Categories: | Building Blocks;C10 to C11;Carbonyl Compounds;Chemical Synthesis;Organic Building Blocks;Aromatics, Impurities, Pharmaceuticals, Intermediates & Fine Chemicals;Aromatics;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals;Esters;Aromatic Esters;C10 to C11;Carbonyl Compounds;1916-07-0 | | Mol File: | 1916-07-0.mol |  |
| | Methyl 3,4,5-trimethoxybenzoate Chemical Properties |
| Melting point | 82-84 °C (lit.) | | Boiling point | 274-275 °C (lit.) | | density | 1.2668 (rough estimate) | | refractive index | 1.5140 (estimate) | | Fp | 274-275°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Solid | | color | White to Off-White | | BRN | 2218156 | | InChI | InChI=1S/C11H14O5/c1-13-8-5-7(11(12)16-4)6-9(14-2)10(8)15-3/h5-6H,1-4H3 | | InChIKey | KACHFMOHOPLTNX-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(OC)=C(OC)C(OC)=C1 | | LogP | 1.740 (est) | | CAS DataBase Reference | 1916-07-0(CAS DataBase Reference) | | NIST Chemistry Reference | Benzoic acid, 3,4,5-trimethoxy-, methyl ester(1916-07-0) | | EPA Substance Registry System | Benzoic acid, 3,4,5-trimethoxy-, methyl ester (1916-07-0) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | DI0820000 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29189900 | | Storage Class | 11 - Combustible Solids |
| | Methyl 3,4,5-trimethoxybenzoate Usage And Synthesis |
| Chemical Properties | white to light yellow powder | | Uses | Trimebutine (T795605) impurity standard. | | Definition | ChEBI: Methyl EudesMate is a trihydroxybenzoic acid. | | Origin | Methyl 3,4,5-trimethoxybenzoate is a natural product found in Buxus natalensis, Eucalyptus aggregata, and other organisms with data available. |
| | Methyl 3,4,5-trimethoxybenzoate Preparation Products And Raw materials |
| Raw materials | Dimethyl sulfate-->Tetrabutylammonium bromide-->Tannic acid-->Methyl benzoate-->3,4,5-Trimethoxy benzoic acid-->(4'-O-methyl)methyl gallate-->Methyl 4,5-dimethoxy-3-hydroxybenzoate-->3,4,5-Trimethoxybenzyl alcohol-->Methyl gallate-->3,4,5-Trimethoxybenzaldehyde-->3,4,5-Trimethoxybenzoyl chloride-->Gallic acid-->Iodomethane | | Preparation Products | 3,4,5-TRIMETHOXYBENZHYDRAZIDE-->2,3-Dimethoxy-5-methyl-p-benzoquinone-->5-BROMOMETHYL-1,2,3-TRIMETHOXY-BENZENE-->5-(Chloromethyl)-1,2,3-trimethoxybenzene-->Methyl syringate-->2,6-DIMETHOXY-4-METHYLPHENOL |
|