- H-CYS(ACM)-OH HCL
-
- $0.00 / 1g
-
2019-11-08
- CAS:28798-28-9
- Min. Order: 1g
- Purity: 98%min
- Supply Ability: 20kg/month
- H-CYS(ACM)-OH HCL
-
- $1.00 / 1KG
-
2019-07-06
- CAS:28798-28-9
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1kg,5kg,100kg
|
| | H-CYS(ACM)-OH HCL Basic information |
| Product Name: | H-CYS(ACM)-OH HCL | | Synonyms: | S-ACETAMIDOMETHYL-L-CYSTEINE HYDROCHLORIDE;S-ACETAMIDOMETHYL-L-CYSTEINE HYDROCHLORIDE SALT;S-(acetamidomethyl)-L-cysteine monohydrochloride;S-Acetamidometahyl-L-cysteine hydrochloride;H-CYS(ACM)-OH HCL;H-CYS(ACM) HCL;CYSTEINE(ACM)-OH HCL;(2R)-2-amino-3-[(acetamidomethyl)sulfanyl]propanoic acid hydrochloride | | CAS: | 28798-28-9 | | MF: | C6H12N2O3S.ClH | | MW: | 228.7 | | EINECS: | 249-230-5 | | Product Categories: | Amino Acids and Derivatives;Amino Acids | | Mol File: | 28798-28-9.mol |  |
| | H-CYS(ACM)-OH HCL Chemical Properties |
| Melting point | ~165 °C (dec.) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Solid | | color | white | | Optical Rotation | [α]20/D 28±2°, c = 1% in H2O | | BRN | 4015821 | | Major Application | peptide synthesis | | InChI | 1S/C6H12N2O3S.ClH/c1-4(9)8-3-12-2-5(7)6(10)11;/h5H,2-3,7H2,1H3,(H,8,9)(H,10,11);1H/t5-;/m0./s1 | | InChIKey | SZWPOAKLKGUXDD-JEDNCBNOSA-N | | SMILES | Cl.CC(=O)NCSC[C@H](N)C(O)=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3-10-21 | | Storage Class | 11 - Combustible Solids |
| | H-CYS(ACM)-OH HCL Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | H-CYS(ACM)-OH HCL Preparation Products And Raw materials |
|