| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
|
| | 1H-Pyrrole-2-carboxylic acid, 1-Methyl-5-nitro-, Methyl ester Basic information |
| | 1H-Pyrrole-2-carboxylic acid, 1-Methyl-5-nitro-, Methyl ester Chemical Properties |
| Melting point | 112 °C(Solv: methanol (67-56-1)) | | Boiling point | 305.2±22.0 °C(Predicted) | | density | 1.36±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | -14.94±0.70(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C7H8N2O4/c1-8-5(7(10)13-2)3-4-6(8)9(11)12/h3-4H,1-2H3 | | InChIKey | XTRZUZWXTWKINM-UHFFFAOYSA-N | | SMILES | N1(C)C([N+]([O-])=O)=CC=C1C(OC)=O |
| | 1H-Pyrrole-2-carboxylic acid, 1-Methyl-5-nitro-, Methyl ester Usage And Synthesis |
| | 1H-Pyrrole-2-carboxylic acid, 1-Methyl-5-nitro-, Methyl ester Preparation Products And Raw materials |
|