|
|
| | 5,5'‐
bis(triMethylstannyl)‐
2,2'‐bithiophene Basic information |
| Product Name: | 5,5'‐
bis(triMethylstannyl)‐
2,2'‐bithiophene | | Synonyms: | 5,5'‐
bis(triMethylstannyl)‐
2,2'‐bithiophene;5,5'-Bis(trimethyltin)-2,2'-bithiophene;5,5-Ditrimethylstannyl-2,2'-bithiophene;5,5'-Bis(trimethylstannyl)-2,2'-bithiophene 97%;5,5'-bis(trimethylstannyl)-2,2'-bithiophenc;Chemical Name:;2TH-2Sn;5,5'-Bis-trimethylstannanyl-[2,2']bithiophenyl | | CAS: | 143367-56-0 | | MF: | C14H22S2Sn2 | | MW: | 491.87 | | EINECS: | | | Product Categories: | Thiophene | | Mol File: | 143367-56-0.mol |  |
| | 5,5'‐
bis(triMethylstannyl)‐
2,2'‐bithiophene Chemical Properties |
| Melting point | 96-100°C | | Boiling point | 418.2±55.0 °C(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | flakes | | color | White | | InChI | InChI=1S/C8H4S2.6CH3.2Sn/c1-3-7(9-5-1)8-4-2-6-10-8;;;;;;;;/h1-4H;6*1H3;; | | InChIKey | DOIRPCDOGSNNCS-UHFFFAOYSA-N | | SMILES | C1(C2SC([Sn](C)(C)C)=CC=2)SC([Sn](C)(C)C)=CC=1 |
| Hazard Codes | T+,N | | Risk Statements | 26/27/28-50/53 | | Safety Statements | 26-27-28-45-60-61 | | RIDADR | UN 3146 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| | 5,5'‐
bis(triMethylstannyl)‐
2,2'‐bithiophene Usage And Synthesis |
| Description | 5,5'-bis(trimethylstannyl)-2,2'-bithiophenecan be used for the synthesis of small molecules and polymer semiconductors for OFETs, OLED, PLED, OPV applications.5,5'-bis(trimethylstannyl)-2,2'-bithiophene can be prepared from 2,2'-bithiophene which is an electron rich and donating unit if it is embedded into low band-gap polymer semiconductors. |
| | 5,5'‐
bis(triMethylstannyl)‐
2,2'‐bithiophene Preparation Products And Raw materials |
|